cas: 125314-13-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CP21R7, 99.74% (CAS 125314-13-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 5 mg, 10 mg, 10mM/1mL, 1 mg, 25 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100207-100 mg |
| cas | 125314-13-8 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 3575,14 Pln | |
| MedChemExpress | 5 mg | 593,69 Pln | |
| MedChemExpress | 10 mg | 886,26 Pln | |
| MedChemExpress | 10mM/1mL | 561,18 Pln | |
| MedChemExpress | 1 mg | 324,34 Pln | |
| MedChemExpress | 25 mg | 1657,16 Pln | |
| MedChemExpress | 50 mg | 2423,42 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.74% |
3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (CAS 125314-13-8) to związek chemiczny o wzorze sumarycznym C19H15N3O2 i masie molowej 317.3 g/mol. Nazwa systematyczna IUPAC: 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione. InChIKey: RGTAEYDIDMGJLX-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H15N3O2 |
|---|---|
| Masa molowa | 317.3 g/mol |
| Nazwa IUPAC | 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| InChIKey | RGTAEYDIDMGJLX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CC(=CC=C4)N |
Dane obliczone przez PubChem (NCBI)