cas: 1370032-20-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
CUR5g, 98.69% (CAS 1370032-20-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 10mM/1mL, 100 mg, 25 mg, 50 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-152100-5 mg |
| cas | 1370032-20-4 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 1462,12 Pln | |
| MedChemExpress | 10mM/1mL | 1596,79 Pln | |
| MedChemExpress | 100 mg | 10192,84 Pln | |
| MedChemExpress | 25 mg | 4341,40 Pln | |
| MedChemExpress | 50 mg | 6835,22 Pln | |
| MedChemExpress | 10 mg | 2233,02 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.69% |
(3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one (CAS 1370032-20-4) to związek chemiczny o wzorze sumarycznym C22H20N2O2 i masie molowej 344.4 g/mol. Nazwa systematyczna IUPAC: (3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one. InChIKey: JMVVTYLZZDOERS-ODPUSEOTSA-N.
| Wzór sumaryczny | C22H20N2O2 |
|---|---|
| Masa molowa | 344.4 g/mol |
| Nazwa IUPAC | (3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one |
| InChIKey | JMVVTYLZZDOERS-ODPUSEOTSA-N |
| SMILES | CN1C/C(=C\C2=CC=C(C=C2)O)/C(=O)/C(=C/C3=CNC4=CC=CC=C43)/C1 |
Dane obliczone przez PubChem (NCBI)