Caffeic acid (Standard), 99.29%
cas: 331-39-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Caffeic acid (Standard), 99.29% (CAS 331-39-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 25 mg, 10 mg, 250 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-N0172R-100 mg |
| cas | 331-39-5 |
| opakowanie | 100 mg |
| dostępność | In stock |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 695,86 Pln | |
| MedChemExpress | 25 mg | 375,42 Pln | |
| MedChemExpress | 10 mg | 263,96 Pln | |
| MedChemExpress | 250 mg | 1155,61 Pln | |
| MedChemExpress | 50 mg | 505,45 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.29% |
(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (CAS 331-39-5) to związek chemiczny o wzorze sumarycznym C9H8O4 i masie molowej 180.16 g/mol. Nazwa systematyczna IUPAC: (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid. InChIKey: QAIPRVGONGVQAS-DUXPYHPUSA-N.
| Wzór sumaryczny | C9H8O4 |
|---|---|
| Masa molowa | 180.16 g/mol |
| Nazwa IUPAC | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| InChIKey | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
caffeic acid, 3,4-Dihydroxycinnamic acid, 3,4-Dihydroxybenzeneacrylic acid, 3-(3,4-Dihydroxyphenyl)-2-propenoic acid, Cinnamic acid, 3,4-dihydroxy-, (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, 4-(2-Carboxyethenyl)-1,2-dihydroxybenzene, 3-(3,4-Dihydroxyphenyl)propenoic acid, 4-(2'-Carboxyvinyl)-1,2-dihydroxybenzene