Caryophyllene oxide, 95%, 95%
cas: 1139-30-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Caryophyllene oxide, 95%, 95% (CAS 1139-30-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 25mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1188XT-250mg |
| cas | 1139-30-6 |
| opakowanie | 250mg |
| dostępność | 125g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 131,60 Pln | |
| Chemat | 5g | 299,60 Pln | |
| Chemat | 10g | 467,60 Pln | |
| Chemat | 25g | 774,80 Pln | |
| Chemat | 25mg | 78,80 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane (CAS 1139-30-6) to związek chemiczny o wzorze sumarycznym C15H24O i masie molowej 220.35 g/mol. Nazwa systematyczna IUPAC: (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane. InChIKey: NVEQFIOZRFFVFW-RGCMKSIDSA-N.
| Wzór sumaryczny | C15H24O |
|---|---|
| Masa molowa | 220.35 g/mol |
| Nazwa IUPAC | (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane |
| InChIKey | NVEQFIOZRFFVFW-RGCMKSIDSA-N |
| SMILES | C[C@@]12CC[C@@H]3[C@H](CC3(C)C)C(=C)CC[C@H]1O2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Caryophyllene oxide, beta-Caryophyllene oxide, Caryophylene oxide, Epoxycaryophyllene, trans-caryophyllene oxide, (-)-BETA-CARYOPHYLLENE EPOXIDE, (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane, (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo(8.2.0.04,6)dodecane, (-)-Caryophyllene oxide, (-)Carophyllene oxide