cas: 1160707-20-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Chloro(mesitylene)[(1R,2R)-(-)-2-amino-1,2-diphenylethyl(methylsulfonylamido)]ruthenium(II), 98%, 98% (CAS 1160707-20-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119WAP-100mg |
| cas | 1160707-20-9 |
| opakowanie | 100mg |
| dostępność | 3g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 347,60 Pln | |
| Chemat | 250mg | 650,00 Pln | |
| Chemat | 1g | 1907,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2-amino-1,2-diphenylethyl)-methylsulfonylazanide;chlororuthenium(1+);1,3,5-trimethylbenzene (CAS 1160707-20-9) to związek chemiczny o wzorze sumarycznym C24H29ClN2O2RuS i masie molowej 546.1 g/mol. Nazwa systematyczna IUPAC: (2-amino-1,2-diphenylethyl)-methylsulfonylazanide;chlororuthenium(1+);1,3,5-trimethylbenzene. InChIKey: IACBEXZXCYLFOG-UHFFFAOYSA-M.
| Wzór sumaryczny | C24H29ClN2O2RuS |
|---|---|
| Masa molowa | 546.1 g/mol |
| Nazwa IUPAC | (2-amino-1,2-diphenylethyl)-methylsulfonylazanide;chlororuthenium(1+);1,3,5-trimethylbenzene |
| InChIKey | IACBEXZXCYLFOG-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC(=C1)C)C.CS(=O)(=O)[N-]C(C1=CC=CC=C1)C(C2=CC=CC=C2)N.Cl[Ru+] |
Dane obliczone przez PubChem (NCBI)