cas: 1891-95-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Chloroxynil, 98.91% (CAS 1891-95-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 5 g, 50 g, 500 mg, 25 g, 250 mg, 1 g, 100 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W059747-10 g |
| cas | 1891-95-8 |
| opakowanie | 10 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 1759,33 Pln | |
| MedChemExpress | 5 g | 1150,97 Pln | |
| MedChemExpress | 50 g | 5358,43 Pln | |
| MedChemExpress | 500 mg | 384,71 Pln | |
| MedChemExpress | 25 g | 3394,02 Pln | |
| MedChemExpress | 250 mg | 287,18 Pln | |
| MedChemExpress | 1 g | 533,32 Pln | |
| MedChemExpress | 100 g | 8516,35 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.91% |
3,5-dichloro-4-hydroxybenzonitrile (CAS 1891-95-8) to związek chemiczny o wzorze sumarycznym C7H3Cl2NO i masie molowej 188.01 g/mol. Nazwa systematyczna IUPAC: 3,5-dichloro-4-hydroxybenzonitrile. InChIKey: YRSSHOVRSMQULE-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H3Cl2NO |
|---|---|
| Masa molowa | 188.01 g/mol |
| Nazwa IUPAC | 3,5-dichloro-4-hydroxybenzonitrile |
| InChIKey | YRSSHOVRSMQULE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)C#N |
Dane obliczone przez PubChem (NCBI)