cas: 862090-74-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Chymase-IN-1 (CAS 862090-74-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg. Oferty producentów: Chemat, MedChemExpress.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12EO2G-1mg |
| cas | 862090-74-2 |
| opakowanie | 1mg |
| dostępność | 0.5g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 803,60 Pln | |
| Chemat | 5mg | 1922,00 Pln | |
| Chemat | 10mg | 2718,80 Pln | |
| Chemat | 25mg | 4072,40 Pln | |
| Chemat | 50mg | 5387,60 Pln | |
| Chemat | 100mg | 7288,40 Pln | |
| Chemat | 500mg | 14594,00 Pln | |
| MedChemExpress | 1 mg | 2265,53 Pln |
| czas dostawy | 3 tygodnie |
|---|
[1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid (CAS 862090-74-2) to związek chemiczny o wzorze sumarycznym C20H15ClNO4PS i masie molowej 431.8 g/mol. Nazwa systematyczna IUPAC: [1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid. InChIKey: HUJXISJLAPAFBO-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H15ClNO4PS |
|---|---|
| Masa molowa | 431.8 g/mol |
| Nazwa IUPAC | [1-(5-chloro-1-benzothiophen-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
| InChIKey | HUJXISJLAPAFBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)C(C3=CSC4=C3C=C(C=C4)Cl)P(=O)(O)O |
Dane obliczone przez PubChem (NCBI)