Cletoquine oxalate
cas: 14142-64-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Cletoquine oxalate (CAS 14142-64-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 25mg, 50mg, 100mg, 1mg, 10mg. Oferty producentów: TargetMol, GLPBio.
| producent | TargetMol |
|---|---|
| nr katalogowy | T10835L-5mg |
| cas | 14142-64-4 |
| opakowanie | 5mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 5mg | 3945,30 Pln | |
| TargetMol | 25mg | 9789,65 Pln | |
| TargetMol | 50mg | 12691,41 Pln | |
| TargetMol | 100mg | 15972,19 Pln | |
| GLPBio | 1mg | 1593,99 Pln | |
| GLPBio | 10mg | 5403,91 Pln | |
| GLPBio | 100mg | 19941,55 Pln | |
| GLPBio | 5mg | 3452,14 Pln | |
| GLPBio | 50mg | 14516,85 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | ok. 33 dni |
2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid (CAS 14142-64-4) to związek chemiczny o wzorze sumarycznym C18H24ClN3O5 i masie molowej 397.9 g/mol. Nazwa systematyczna IUPAC: 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid. InChIKey: DTVGVTDECKJJJK-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H24ClN3O5 |
|---|---|
| Masa molowa | 397.9 g/mol |
| Nazwa IUPAC | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid |
| InChIKey | DTVGVTDECKJJJK-UHFFFAOYSA-N |
| SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl.C(=O)(C(=O)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Cletoquine Oxalate, Cletoquine (oxalate), 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid, Desethylhydroxychloroquine (oxalate), starbld0000859, C18H24ClN3O5, orb1710031, Hydroxychloroquine EP Impurity C Oxalate, 2-[4-[(7-chloro-4-quinolyl)amino]pentylamino]ethanol;oxalic acid, Oxalic acid--2-({4-[(7-chloroquinolin-4-yl)amino]pentyl}amino)ethan-1-ol (1/1)