cas: 60200-06-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Clorsulon, 99.99% (CAS 60200-06-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 100 mg, 50 g, 10mM/1mL, 500 mg, 5 g, 100 g, 10 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B0488-1 g |
| cas | 60200-06-8 |
| opakowanie | 1 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 551,89 Pln | |
| MedChemExpress | 100 mg | 240,74 Pln | |
| MedChemExpress | 50 g | 2279,46 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln | |
| MedChemExpress | 500 mg | 417,22 Pln | |
| MedChemExpress | 5 g | 983,78 Pln | |
| MedChemExpress | 100 g | 2999,28 Pln | |
| MedChemExpress | 10 g | 1248,49 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.99% |
4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonamide (CAS 60200-06-8) to związek chemiczny o wzorze sumarycznym C8H8Cl3N3O4S2 i masie molowej 380.7 g/mol. Nazwa systematyczna IUPAC: 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonamide. InChIKey: QOVTVIYTBRHADL-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H8Cl3N3O4S2 |
|---|---|
| Masa molowa | 380.7 g/mol |
| Nazwa IUPAC | 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonamide |
| InChIKey | QOVTVIYTBRHADL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)S(=O)(=O)N)S(=O)(=O)N)C(=C(Cl)Cl)Cl |
Dane obliczone przez PubChem (NCBI)