cas: 1032678-01-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Cyanine3 carboxylic acid (chloride), 99.77% (CAS 1032678-01-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 10 mg, 50 mg, 100 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-D1623-5 mg |
| cas | 1032678-01-5 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 440,44 Pln | |
| MedChemExpress | 10 mg | 640,13 Pln | |
| MedChemExpress | 50 mg | 1680,38 Pln | |
| MedChemExpress | 100 mg | 2460,58 Pln | |
| MedChemExpress | 25 mg | 1155,61 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.77% |
6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride (CAS 1032678-01-5) to związek chemiczny o wzorze sumarycznym C30H37ClN2O2 i masie molowej 493.1 g/mol. Nazwa systematyczna IUPAC: 6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride. InChIKey: ITDHYDSGULGMLR-UHFFFAOYSA-N.
| Wzór sumaryczny | C30H37ClN2O2 |
|---|---|
| Masa molowa | 493.1 g/mol |
| Nazwa IUPAC | 6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride |
| InChIKey | ITDHYDSGULGMLR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/3\C(C4=CC=CC=C4N3CCCCCC(=O)O)(C)C)C)C.[Cl-] |
Dane obliczone przez PubChem (NCBI)