cas: 1803099-44-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Cyanine7.5 carboxylic acid, 95% (CAS 1803099-44-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 25mg, 50mg, 100mg. Oferty producentów: Lumiprobe.
| producent | Lumiprobe |
|---|---|
| nr katalogowy | LP-x6090-1mg |
| cas | 1803099-44-6 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Lumiprobe | 1mg | 638,23 Pln | |
| Lumiprobe | 5mg | 1152,73 Pln | |
| Lumiprobe | 25mg | 2078,83 Pln | |
| Lumiprobe | 50mg | 3267,08 Pln | |
| Lumiprobe | 100mg | 5608,05 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 2 weeks |
6-[1,1-dimethyl-2-[2-[3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]benzo[e]indol-3-yl]hexanoic acid chloride (CAS 1803099-44-6) to związek chemiczny o wzorze sumarycznym C45H49ClN2O2 i masie molowej 685.3 g/mol. Nazwa systematyczna IUPAC: 6-[1,1-dimethyl-2-[2-[3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]benzo[e]indol-3-yl]hexanoic acid chloride. InChIKey: NENPZWGBKUDTPW-UHFFFAOYSA-N.
| Wzór sumaryczny | C45H49ClN2O2 |
|---|---|
| Masa molowa | 685.3 g/mol |
| Nazwa IUPAC | 6-[1,1-dimethyl-2-[2-[3-[2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]benzo[e]indol-3-yl]hexanoic acid chloride |
| InChIKey | NENPZWGBKUDTPW-UHFFFAOYSA-N |
| SMILES | CC1(C(=[N+](C2=C1C3=CC=CC=C3C=C2)C)C=CC4=CC(=CC=C5C(C6=C(N5CCCCCC(=O)O)C=CC7=CC=CC=C76)(C)C)CCC4)C.[Cl-] |
Dane obliczone przez PubChem (NCBI)