cas: 103404-75-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
D-Luciferin (sodium), 99.91% (CAS 103404-75-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 10 mg, 100 mg, 5 mg, 500 mg, 1 g, 5 g, 200 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-12591-50 mg |
| cas | 103404-75-7 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 454,37 Pln | |
| MedChemExpress | 10 mg | 384,71 Pln | |
| MedChemExpress | 100 mg | 621,55 Pln | |
| MedChemExpress | 5 mg | 287,18 Pln | |
| MedChemExpress | 500 mg | 1415,68 Pln | |
| MedChemExpress | 1 g | 1847,57 Pln | |
| MedChemExpress | 5 g | 4438,92 Pln | |
| MedChemExpress | 200 mg | 839,82 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.91% |
Sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 103404-75-7) to związek chemiczny o wzorze sumarycznym C11H7N2NaO3S2 i masie molowej 302.3 g/mol. Nazwa systematyczna IUPAC: sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: LILQLBIQROYWIA-OGFXRTJISA-M.
| Wzór sumaryczny | C11H7N2NaO3S2 |
|---|---|
| Masa molowa | 302.3 g/mol |
| Nazwa IUPAC | sodium (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | LILQLBIQROYWIA-OGFXRTJISA-M |
| SMILES | C1[C@@H](N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[Na+] |
Dane obliczone przez PubChem (NCBI)