cas: 1155877-97-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
D159687, 98.34% (CAS 1155877-97-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 5 mg, 10 mg, 25 mg, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15444-10mM/1mL |
| cas | 1155877-97-6 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 407,93 Pln | |
| MedChemExpress | 5 mg | 384,71 Pln | |
| MedChemExpress | 10 mg | 542,60 Pln | |
| MedChemExpress | 25 mg | 969,85 Pln | |
| MedChemExpress | 100 mg | 2037,97 Pln | |
| MedChemExpress | 50 mg | 1397,10 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.34% |
[4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea (CAS 1155877-97-6) to związek chemiczny o wzorze sumarycznym C21H19ClN2O2 i masie molowej 366.8 g/mol. Nazwa systematyczna IUPAC: [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea. InChIKey: RJJLUTWHJUDZFP-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H19ClN2O2 |
|---|---|
| Masa molowa | 366.8 g/mol |
| Nazwa IUPAC | [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]urea |
| InChIKey | RJJLUTWHJUDZFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=CC=C(C=C2)NC(=O)N)C3=CC(=CC=C3)Cl |
Dane obliczone przez PubChem (NCBI)