cas: 83373-60-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
D609, 98.0% (CAS 83373-60-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-70072-100 mg |
| cas | 83373-60-8 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 1847,57 Pln | |
| MedChemExpress | 5 mg | 435,79 Pln | |
| MedChemExpress | 25 mg | 937,34 Pln | |
| MedChemExpress | 10 mg | 630,84 Pln | |
| MedChemExpress | 50 mg | 1299,58 Pln | |
| MedChemExpress | 10mM/1mL | 468,30 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.0% |
Potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate (CAS 83373-60-8) to związek chemiczny o wzorze sumarycznym C11H15KOS2 i masie molowej 266.5 g/mol. Nazwa systematyczna IUPAC: potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate. InChIKey: IGULCCCBGBDZKQ-UHFFFAOYSA-M.
| Wzór sumaryczny | C11H15KOS2 |
|---|---|
| Masa molowa | 266.5 g/mol |
| Nazwa IUPAC | potassium 8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate |
| InChIKey | IGULCCCBGBDZKQ-UHFFFAOYSA-M |
| SMILES | C1CC2C(C1)C3CC2CC3OC(=S)[S-].[K+] |
Dane obliczone przez PubChem (NCBI)