cas: 113411-17-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
DIF-3 (CAS 113411-17-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol, Chemat.
| producent | TargetMol |
|---|---|
| nr katalogowy | T60485-1mg |
| cas | 113411-17-9 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 784,16 Pln | |
| TargetMol | 5mg | 1754,02 Pln | |
| TargetMol | 10mg | 2524,32 Pln | |
| TargetMol | 25mg | 4104,62 Pln | |
| TargetMol | 50mg | 5764,85 Pln | |
| TargetMol | 100mg | 7704,02 Pln | |
| TargetMol | 500mg | 15527,22 Pln | |
| Chemat | 1mg | 621,20 Pln | |
| Chemat | 5mg | 1720,40 Pln | |
| Chemat | 10mg | 2522,00 Pln | |
| Chemat | 25mg | 4000,40 Pln | |
| Chemat | 50mg | 5392,40 Pln | |
| Chemat | 100mg | 6856,40 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CAS 113411-17-9) to związek chemiczny o wzorze sumarycznym C13H17ClO4 i masie molowej 272.72 g/mol. Nazwa systematyczna IUPAC: 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one. InChIKey: JWBMZIJMSBFBIY-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H17ClO4 |
|---|---|
| Masa molowa | 272.72 g/mol |
| Nazwa IUPAC | 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| InChIKey | JWBMZIJMSBFBIY-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C1=C(C(=C(C=C1O)OC)Cl)O |
Dane obliczone przez PubChem (NCBI)