cas: 1215833-62-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
DMCM (hydrochloride), 99.07% (CAS 1215833-62-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 50 mg, 25 mg, 5 mg, 100 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100369A-10mM/1mL |
| cas | 1215833-62-7 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 621,55 Pln | |
| MedChemExpress | 50 mg | 2952,84 Pln | |
| MedChemExpress | 25 mg | 1657,16 Pln | |
| MedChemExpress | 5 mg | 575,11 Pln | |
| MedChemExpress | 100 mg | 4197,43 Pln | |
| MedChemExpress | 10 mg | 793,38 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.07% |
Methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 1215833-62-7) to związek chemiczny o wzorze sumarycznym C17H19ClN2O4 i masie molowej 350.8 g/mol. Nazwa systematyczna IUPAC: methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: FHCRBVQGMZUJKY-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H19ClN2O4 |
|---|---|
| Masa molowa | 350.8 g/mol |
| Nazwa IUPAC | methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | FHCRBVQGMZUJKY-UHFFFAOYSA-N |
| SMILES | CCC1=C2C3=CC(=C(C=C3NC2=CN=C1C(=O)OC)OC)OC.Cl |
Dane obliczone przez PubChem (NCBI)