cas: 404951-53-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dacinostat, 98.45% (CAS 404951-53-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 50 mg, 500 mg, 100 mg, 10 mg, 10mM/1mL, 5 mg, 1 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-13606-25 mg |
| cas | 404951-53-7 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2163,36 Pln | |
| MedChemExpress | 50 mg | 3161,82 Pln | |
| MedChemExpress | 500 mg | 8850,72 Pln | |
| MedChemExpress | 100 mg | 4387,84 Pln | |
| MedChemExpress | 10 mg | 1262,42 Pln | |
| MedChemExpress | 10mM/1mL | 1378,52 Pln | |
| MedChemExpress | 5 mg | 853,75 Pln | |
| MedChemExpress | 1 g | 14130,95 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.45% |
(E)-N-hydroxy-3-[4-[[2-hydroxyethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]prop-2-enamide (CAS 404951-53-7) to związek chemiczny o wzorze sumarycznym C22H25N3O3 i masie molowej 379.5 g/mol. Nazwa systematyczna IUPAC: (E)-N-hydroxy-3-[4-[[2-hydroxyethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]prop-2-enamide. InChIKey: BWDQBBCUWLSASG-MDZDMXLPSA-N.
| Wzór sumaryczny | C22H25N3O3 |
|---|---|
| Masa molowa | 379.5 g/mol |
| Nazwa IUPAC | (E)-N-hydroxy-3-[4-[[2-hydroxyethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]prop-2-enamide |
| InChIKey | BWDQBBCUWLSASG-MDZDMXLPSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCN(CCO)CC3=CC=C(C=C3)/C=C/C(=O)NO |
Dane obliczone przez PubChem (NCBI)