cas: 169590-41-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Deracoxib, 99.65% (CAS 169590-41-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 100 mg, 25 mg, 10mM/1mL, 500 mg, 50 mg, 250 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-17509-1 g |
| cas | 169590-41-4 |
| opakowanie | 1 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 1081,31 Pln | |
| MedChemExpress | 100 mg | 389,35 Pln | |
| MedChemExpress | 25 mg | 240,74 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln | |
| MedChemExpress | 500 mg | 802,67 Pln | |
| MedChemExpress | 50 mg | 296,47 Pln | |
| MedChemExpress | 250 mg | 607,62 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.65% |
4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]benzenesulfonamide (CAS 169590-41-4) to związek chemiczny o wzorze sumarycznym C17H14F3N3O3S i masie molowej 397.4 g/mol. Nazwa systematyczna IUPAC: 4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: WAZQAZKAZLXFMK-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H14F3N3O3S |
|---|---|
| Masa molowa | 397.4 g/mol |
| Nazwa IUPAC | 4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | WAZQAZKAZLXFMK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)F)F |
Dane obliczone przez PubChem (NCBI)