Dibenzo[b,d]furan-4-carboxylic acid, 95%
cas: 2786-05-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dibenzo[b,d]furan-4-carboxylic acid, 95% (CAS 2786-05-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: BLDpharm.
| producent | BLDpharm |
|---|---|
| nr katalogowy | BD105578-250mg |
| cas | 2786-05-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| BLDpharm | 250mg | 214,39 Pln | |
| BLDpharm | 1g | 269,93 Pln | |
| BLDpharm | 5g | 525,40 Pln | |
| BLDpharm | 25g | 2302,55 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Dibenzofuran-4-carboxylic acid (CAS 2786-05-2) to związek chemiczny o wzorze sumarycznym C13H8O3 i masie molowej 212.20 g/mol. Nazwa systematyczna IUPAC: dibenzofuran-4-carboxylic acid. InChIKey: BSMAWCXKHJSJIB-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H8O3 |
|---|---|
| Masa molowa | 212.20 g/mol |
| Nazwa IUPAC | dibenzofuran-4-carboxylic acid |
| InChIKey | BSMAWCXKHJSJIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
8-oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaene-6-carboxylic acid, 8-Oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaene-6-carboxylic acid, Dibenzofuran-4-carboxylic acid, dibenzo[b,d]furan-4-carboxylic acid, 4-Dibenzofurancarboxylic acid, Dibenzo[b]furan-4-carboxylic acid, Dibenzofuran-4-carboxylic acid, 97%