Diclofenac ethyl ester
cas: 15307-77-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diclofenac ethyl ester (CAS 15307-77-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25mg, 50mg, 100mg, 250mg, 10mg, 1x10mg. Oferty producentów: TargetMol, GLPBio, Biosynth, HPC Standards.
| producent | TargetMol |
|---|---|
| nr katalogowy | T37481-25mg |
| cas | 15307-77-4 |
| opakowanie | 25mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 25mg | 1448,25 Pln | |
| TargetMol | 50mg | 2597,55 Pln | |
| GLPBio | 100mg | 2291,38 Pln | |
| GLPBio | 25mg | 934,04 Pln | |
| GLPBio | 250mg | 4584,83 Pln | |
| GLPBio | 50mg | 1411,45 Pln | |
| Biosynth | 25mg | cena na żądanie | |
| Biosynth | 10mg | cena na żądanie | |
| Biosynth | 50mg | cena na żądanie | |
| Biosynth | 100mg | cena na żądanie | |
| Biosynth | 250mg | cena na żądanie | |
| HPC Standards | 1x10mg | cena na żądanie |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | na zapytanie |
Ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 15307-77-4) to związek chemiczny o wzorze sumarycznym C16H15Cl2NO2 i masie molowej 324.2 g/mol. Nazwa systematyczna IUPAC: ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: YPBCAMNSNFVYQL-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H15Cl2NO2 |
|---|---|
| Masa molowa | 324.2 g/mol |
| Nazwa IUPAC | ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | YPBCAMNSNFVYQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diclofenac Ethyl Ester, Aceclofenac Impurity C, Ethyl diclofenac, Ethyl Ester of Diclofenac, Aceclofenac impurity C [EP], ACECLOFENAC IMPURITY C [EP IMPURITY], ACECLOFENAC IMPURITY C (EP IMPURITY), Aceclofenac EP Impurity C, ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate, ethyl 2-(2-(2,6-dichlorophenylamino)phenyl)acetate