Diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate, ≥95%
cas: 6270-57-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate, ≥95% (CAS 6270-57-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 250mg, 1g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IB3K-50mg |
| cas | 6270-57-1 |
| opakowanie | 50mg |
| dostępność | 2g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 194,00 Pln | |
| Chemat | 250mg | 568,40 Pln | |
| Chemat | 1g | 1480,40 Pln | |
| Fluorochem | 250mg | 1044,44 Pln | |
| Fluorochem | 1g | 2746,97 Pln |
właściwości
| czystość | ≥95% |
|---|---|
| czas dostawy | 3 tygodnie |
Diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate (CAS 6270-57-1) to związek chemiczny o wzorze sumarycznym C10H12O7 i masie molowej 244.20 g/mol. Nazwa systematyczna IUPAC: diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate. InChIKey: JGCMPUKYPRCPRE-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H12O7 |
|---|---|
| Masa molowa | 244.20 g/mol |
| Nazwa IUPAC | diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate |
| InChIKey | JGCMPUKYPRCPRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(O1)C(=O)OCC)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate, 2,5-diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate, 2,5-Furandicarboxylic acid, 3,4-dihydroxy-, diethyl ester, diethyl 3,4-dihydroxy-2,5-furandicarboxylate, Maybridge4_000491, JGCMPUKYPRCPRE-UHFFFAOYSA-N, Diethyl 34-dihydroxyfuran-25-dicarboxylate