Diethyl 4,4-difluoroheptanedioate, 97%
cas: 22515-16-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diethyl 4,4-difluoroheptanedioate, 97% (CAS 22515-16-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A221206-250mg |
| cas | 22515-16-8 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 125,62 Pln | |
| Ambeed | 1g | 142,31 Pln | |
| Ambeed | 5g | 381,50 Pln | |
| Ambeed | 10g | 681,88 Pln | |
| Ambeed | 25g | 1471,75 Pln | |
| BLDpharm | 250mg | 125,54 Pln | |
| BLDpharm | 1g | 147,75 Pln | |
| BLDpharm | 5g | 408,77 Pln | |
| BLDpharm | 10g | 730,88 Pln | |
| BLDpharm | 25g | 1580,58 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Diethyl 4,4-difluoroheptanedioate (CAS 22515-16-8) to związek chemiczny o wzorze sumarycznym C11H18F2O4 i masie molowej 252.25 g/mol. Nazwa systematyczna IUPAC: diethyl 4,4-difluoroheptanedioate. InChIKey: XUOBBVMKXUPPEW-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H18F2O4 |
|---|---|
| Masa molowa | 252.25 g/mol |
| Nazwa IUPAC | diethyl 4,4-difluoroheptanedioate |
| InChIKey | XUOBBVMKXUPPEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(CCC(=O)OCC)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diethyl 4,4-difluoroheptanedioate, 1,7-diethyl 4,4-difluoroheptanedioate, Diethyl 4,4-difluoropimelate, Diethyl4,4-difluoroheptanedioate, Diethyl 4,4-difluoroheptane-1,7-dioate, 4,4-difluoro-heptanedioic acid diethyl ester, Diethyl 4,4-difluoroheptanedio, Diethyl 4,4-difluoropimelate,, 4,4-Difluoro heptanoic acid diethyl ester, Diethyl 4,4-difluoroheptane-1,7-dioate 96%