Dimethyl 4,4'-(ethyne-1,2-diyl)dibenzoate, 98%
cas: 16882-08-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dimethyl 4,4'-(ethyne-1,2-diyl)dibenzoate, 98% (CAS 16882-08-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg, 10g, 25g. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1359211-250mg |
| cas | 16882-08-9 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 242,44 Pln | |
| Ambeed | 1g | 442,69 Pln | |
| Ambeed | 5g | 1338,25 Pln | |
| Chemat | 100mg | 107,60 Pln | |
| Chemat | 250mg | 122,00 Pln | |
| Chemat | 1g | 280,40 Pln | |
| Chemat | 5g | 875,60 Pln | |
| Chemat | 10g | 1662,80 Pln | |
| Chemat | 25g | 3261,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Methyl 4-[2-(4-methoxycarbonylphenyl)ethynyl]benzoate (CAS 16882-08-9) to związek chemiczny o wzorze sumarycznym C18H14O4 i masie molowej 294.3 g/mol. Nazwa systematyczna IUPAC: methyl 4-[2-(4-methoxycarbonylphenyl)ethynyl]benzoate. InChIKey: HVBNYTAAHLESOR-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H14O4 |
|---|---|
| Masa molowa | 294.3 g/mol |
| Nazwa IUPAC | methyl 4-[2-(4-methoxycarbonylphenyl)ethynyl]benzoate |
| InChIKey | HVBNYTAAHLESOR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Dimethyl 4,4'-(ethyne-1,2-diyl)dibenzoate, benzoic acid, 4,4'-(1,2-ethynediyl)bis-, dimethyl ester, methyl 4-[2-(4-methoxycarbonylphenyl)ethynyl]benzoate, bis(4-(methoxycarbonyl)phenyl)acetylene, benzoic acid, 4,4'-(1,2-ethynediyl)bis-, 1,1'-dimethyl ester, dimethyl 4,4'-ethyne-1,2-diyldibenzoate, Dimethy 4,4'-(ethyne-1,2-diyl)dibenzoate, 1,2-bis(4'-carbomethoxyphenyl)ethyne, 1,2-bis(4-methoxycarbonylphenyl)acetylene, 1,1'-Dimethyl 4,4'-(1,2-ethynediyl)bis[benzoate