Dimethyl 4,5-dihydroxyphthalate, 97%, 97%
cas: 66323-03-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dimethyl 4,5-dihydroxyphthalate, 97%, 97% (CAS 66323-03-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IBL8-50mg |
| cas | 66323-03-3 |
| opakowanie | 50mg |
| dostępność | 30g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 150,80 Pln | |
| Chemat | 100mg | 174,80 Pln | |
| Chemat | 250mg | 237,20 Pln | |
| Chemat | 1g | 755,60 Pln | |
| Chemat | 5g | 2584,40 Pln | |
| Chemat | 10g | 4096,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Dimethyl 4,5-dihydroxybenzene-1,2-dicarboxylate (CAS 66323-03-3) to związek chemiczny o wzorze sumarycznym C10H10O6 i masie molowej 226.18 g/mol. Nazwa systematyczna IUPAC: dimethyl 4,5-dihydroxybenzene-1,2-dicarboxylate. InChIKey: FXPCZDQRACWUBW-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H10O6 |
|---|---|
| Masa molowa | 226.18 g/mol |
| Nazwa IUPAC | dimethyl 4,5-dihydroxybenzene-1,2-dicarboxylate |
| InChIKey | FXPCZDQRACWUBW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(=O)OC)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
dimethyl 4,5-dihydroxyphthalate, 1,2-benzenedicarboxylic acid, 4,5-dihydroxy-, dimethyl ester, InChI=1/C10H10O6/c1-15-9(13)5-3-7(11)8(12)4-6(5)10(14)16-2/h3-4,11-12H,1-2H, dimethyl 4,5-dihydroxybenzene-1,2-dicarboxylate, 1,2-dimethyl 4,5-dihydroxybenzene-1,2-dicarboxylate, 4,5-Bis(hydroxy)phthalic acid dimethyl ester, Dimethyl 45-dihydroxyphthalate, dimethyl4,5-dihydroxyphthalate, 4,5-dihydroxy-benzene-1,2-dicarboxylic acid dimethyl ester, 4,5-Dihydroxy-1,2-benzenedicarboxylic acid 1,2-dimethyl ester