Diphenyl p-tolyl phosphate, 97%(mixtures), 97%(mixtures)
cas: 26444-49-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diphenyl p-tolyl phosphate, 97%(mixtures), 97%(mixtures) (CAS 26444-49-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113T92-10g |
| cas | 26444-49-5 |
| opakowanie | 10g |
| dostępność | 1000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 78,80 Pln | |
| Chemat | 25g | 78,80 Pln | |
| Chemat | 100g | 165,20 Pln |
właściwości
| czystość | 97%(mixtures) |
|---|---|
| czas dostawy | 3 tygodnie |
(2-methylphenyl) diphenyl phosphate (CAS 26444-49-5) to związek chemiczny o wzorze sumarycznym C19H17O4P i masie molowej 340.3 g/mol. Nazwa systematyczna IUPAC: (2-methylphenyl) diphenyl phosphate. InChIKey: XMNDMAQKWSQVOV-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H17O4P |
|---|---|
| Masa molowa | 340.3 g/mol |
| Nazwa IUPAC | (2-methylphenyl) diphenyl phosphate |
| InChIKey | XMNDMAQKWSQVOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diphenylcresyl phosphate, Disflamoll DPK, o-Tolyldiphenylphosphate, Diphenyl tolyl phosphate, Tolyl diphenyl phosphate, Phosphoric acid, methylphenyl diphenyl ester, Cresyldiphenyl phosphate, Phosphoric acid, diphenyl tolyl ester, Phosphoric acid, methylphenyldiphenyle, Cresyl diphenyl phosphate