Diphenyl(2-(triethoxysilyl)ethyl)phosphine, 98%
cas: 18586-39-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diphenyl(2-(triethoxysilyl)ethyl)phosphine, 98% (CAS 18586-39-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A888006-250mg |
| cas | 18586-39-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 214,62 Pln | |
| Ambeed | 1g | 359,25 Pln | |
| Ambeed | 5g | 676,31 Pln | |
| Ambeed | 25g | 2612,06 Pln | |
| Chemat | 250mg | 122,00 Pln | |
| Chemat | 1g | 222,80 Pln | |
| Chemat | 5g | 568,40 Pln | |
| Chemat | 25g | 1946,00 Pln | |
| BLDpharm | 250mg | 197,73 Pln | |
| BLDpharm | 1g | 353,23 Pln | |
| BLDpharm | 5g | 725,32 Pln | |
| BLDpharm | 25g | 2646,87 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Diphenyl(2-triethoxysilylethyl)phosphane (CAS 18586-39-5) to związek chemiczny o wzorze sumarycznym C20H29O3PSi i masie molowej 376.5 g/mol. Nazwa systematyczna IUPAC: diphenyl(2-triethoxysilylethyl)phosphane. InChIKey: HLXCYTXLQJWQFG-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H29O3PSi |
|---|---|
| Masa molowa | 376.5 g/mol |
| Nazwa IUPAC | diphenyl(2-triethoxysilylethyl)phosphane |
| InChIKey | HLXCYTXLQJWQFG-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCP(C1=CC=CC=C1)C2=CC=CC=C2)(OCC)OCC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diphenyl(2-(triethoxysilyl)ethyl)phosphine, Diphenyl[2-(triethoxysilyl)ethyl]phosphine, (Triethoxysilyl)ethyl diphenylphosphine, Phosphine, diphenyl(2-(triethoxysilyl)ethyl)-, Phosphine, diphenyl[2-(triethoxysilyl)ethyl]-, diphenyl(2-triethoxysilylethyl)phosphane, C20H29O3PSi, diphenyl(2-(triethoxysilyl)ethyl)phosphane, HLXCYTXLQJWQFG-UHFFFAOYSA-N