Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate, 98%, 98%
cas: 75482-18-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate, 98%, 98% (CAS 75482-18-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 400g, 10g, 15g, 50g, 75g, 200g, 300g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch116X8O-400g |
| cas | 75482-18-7 |
| opakowanie | 400g |
| dostępność | 500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 400g | 1302,80 Pln | |
| Chemat | 10g | 112,40 Pln | |
| Chemat | 15g | 136,40 Pln | |
| Chemat | 50g | 237,20 Pln | |
| Chemat | 75g | 318,80 Pln | |
| Chemat | 200g | 693,20 Pln | |
| Chemat | 300g | 1000,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Diphenyl-(2-phenylsulfanylphenyl)sulfanium hexafluorophosphate (CAS 75482-18-7) to związek chemiczny o wzorze sumarycznym C24H19F6PS2 i masie molowej 516.5 g/mol. Nazwa systematyczna IUPAC: diphenyl-(2-phenylsulfanylphenyl)sulfanium hexafluorophosphate. InChIKey: SFWSATMGMAKCIF-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H19F6PS2 |
|---|---|
| Masa molowa | 516.5 g/mol |
| Nazwa IUPAC | diphenyl-(2-phenylsulfanylphenyl)sulfanium hexafluorophosphate |
| InChIKey | SFWSATMGMAKCIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC=C2[S+](C3=CC=CC=C3)C4=CC=CC=C4.F[P-](F)(F)(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate, ((Phenylthio)phenyl)diphenylsulfonium hexafluorophosphate, Diphenyl((phenylthio)phenyl)sulphonium hexafluorophosphate(1-), Diphenyl[(phenylthio)phenyl]sulphonium hexafluorophosphate(1-), Sulfonium, diphenyl((phenylthio)phenyl)-, hexafluorophosphate(1-), Sulfonium, diphenyl[(phenylthio)phenyl]-, hexafluorophosphate(1-), Diphenyl((phenylthio)phenyl)sulfonium hexafluorophosphate, Diphenyl((phenylthio)phenyl)sulfonium hexafluorophosphate(1-), Diphenyl(p-phenylthiophenyl)sulfonium hexafluorophosphate, diphenyl-(2-phenylsulfanylphenyl)sulfanium;hexafluorophosphate