cas: 1610591-93-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dopamine D2 receptor agonist-2 (CAS 1610591-93-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg. Oferty producentów: TargetMol, Chemat, MedChemExpress.
| producent | TargetMol |
|---|---|
| nr katalogowy | T60075-1mg |
| cas | 1610591-93-9 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 399,00 Pln | |
| TargetMol | 5mg | 605,28 Pln | |
| TargetMol | 10mg | 778,01 Pln | |
| TargetMol | 25mg | 1149,74 Pln | |
| TargetMol | 50mg | 1594,71 Pln | |
| TargetMol | 100mg | 2285,07 Pln | |
| TargetMol | 200mg | 3201,83 Pln | |
| Chemat | 1mg | 208,40 Pln | |
| Chemat | 5mg | 366,80 Pln | |
| Chemat | 10mg | 496,40 Pln | |
| Chemat | 25mg | 774,80 Pln | |
| Chemat | 50mg | 1120,40 Pln | |
| Chemat | 100mg | 1643,60 Pln | |
| Chemat | 200mg | 2320,40 Pln | |
| MedChemExpress | 1 mg | 551,89 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 19 dni |
3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 1610591-93-9) to związek chemiczny o wzorze sumarycznym C25H31Cl2N5OS i masie molowej 520.5 g/mol. Nazwa systematyczna IUPAC: 3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: YEDOJNFKHXVFHD-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H31Cl2N5OS |
|---|---|
| Masa molowa | 520.5 g/mol |
| Nazwa IUPAC | 3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | YEDOJNFKHXVFHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NCCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl)N)C |
Dane obliczone przez PubChem (NCBI)