cas: 1501618-04-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
EIF2α activator 2, 99.57% (CAS 1501618-04-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 10 mg, 5 mg, 50 mg, 10mM/1mL, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-147832-25 mg |
| cas | 1501618-04-7 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2376,98 Pln | |
| MedChemExpress | 10 mg | 1271,71 Pln | |
| MedChemExpress | 5 mg | 839,82 Pln | |
| MedChemExpress | 50 mg | 3719,10 Pln | |
| MedChemExpress | 10mM/1mL | 909,48 Pln | |
| MedChemExpress | 100 mg | 5878,56 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.57% |
1-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea (CAS 1501618-04-7) to związek chemiczny o wzorze sumarycznym C21H20F6N2O2 i masie molowej 446.4 g/mol. Nazwa systematyczna IUPAC: 1-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: MFRDVPYKJUYMDN-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H20F6N2O2 |
|---|---|
| Masa molowa | 446.4 g/mol |
| Nazwa IUPAC | 1-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | MFRDVPYKJUYMDN-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)NC2=CC=CC(=C2)C(F)(F)F)OC3=CC=C(C=C3)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)