cas: 301177-43-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
ESI-08, 98.74% (CAS 301177-43-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10mM/1mL, 5 mg, 25 mg, 10 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-136172-100 mg |
| cas | 301177-43-5 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 6598,38 Pln | |
| MedChemExpress | 10mM/1mL | 909,48 Pln | |
| MedChemExpress | 5 mg | 839,82 Pln | |
| MedChemExpress | 25 mg | 2757,79 Pln | |
| MedChemExpress | 10 mg | 1318,15 Pln | |
| MedChemExpress | 50 mg | 4197,43 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.74% |
4-cyclohexyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile (CAS 301177-43-5) to związek chemiczny o wzorze sumarycznym C20H23N3OS i masie molowej 353.5 g/mol. Nazwa systematyczna IUPAC: 4-cyclohexyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile. InChIKey: LSHOSZQLVLPEGG-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H23N3OS |
|---|---|
| Masa molowa | 353.5 g/mol |
| Nazwa IUPAC | 4-cyclohexyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| InChIKey | LSHOSZQLVLPEGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CSC2=NC(=C(C(=O)N2)C#N)C3CCCCC3 |
Dane obliczone przez PubChem (NCBI)