cas: 114828-90-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Endoxifen (E-isomer), 98.02% (CAS 114828-90-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 50 mg, 100 mg, 10 mg, 10mM/1mL, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-18719D-5 mg |
| cas | 114828-90-9 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 1127,75 Pln | |
| MedChemExpress | 50 mg | 4870,81 Pln | |
| MedChemExpress | 100 mg | 7722,23 Pln | |
| MedChemExpress | 10 mg | 1606,08 Pln | |
| MedChemExpress | 10mM/1mL | 1229,92 Pln | |
| MedChemExpress | 25 mg | 3096,80 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.02% |
4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 114828-90-9) to związek chemiczny o wzorze sumarycznym C25H27NO2 i masie molowej 373.5 g/mol. Nazwa systematyczna IUPAC: 4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: MHJBZVSGOZTKRH-OCOZRVBESA-N.
| Wzór sumaryczny | C25H27NO2 |
|---|---|
| Masa molowa | 373.5 g/mol |
| Nazwa IUPAC | 4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | MHJBZVSGOZTKRH-OCOZRVBESA-N |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)O)\C2=CC=C(C=C2)OCCNC)/C3=CC=CC=C3 |
Dane obliczone przez PubChem (NCBI)