cas: 259525-01-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Enecadin, 98.51% (CAS 259525-01-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 1 mg, 25 mg, 100 mg, 10mM/1mL, 50 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100119-5 mg |
| cas | 259525-01-4 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 4197,43 Pln | |
| MedChemExpress | 1 mg | 1750,04 Pln | |
| MedChemExpress | 25 mg | 8038,02 Pln | |
| MedChemExpress | 100 mg | 14994,73 Pln | |
| MedChemExpress | 10mM/1mL | 3324,36 Pln | |
| MedChemExpress | 50 mg | 10675,81 Pln | |
| MedChemExpress | 10 mg | 5637,07 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.51% |
4-(4-fluorophenyl)-2-methyl-6-(5-piperidin-1-ylpentoxy)pyrimidine (CAS 259525-01-4) to związek chemiczny o wzorze sumarycznym C21H28FN3O i masie molowej 357.5 g/mol. Nazwa systematyczna IUPAC: 4-(4-fluorophenyl)-2-methyl-6-(5-piperidin-1-ylpentoxy)pyrimidine. InChIKey: SZSHJTJCJOWMHM-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H28FN3O |
|---|---|
| Masa molowa | 357.5 g/mol |
| Nazwa IUPAC | 4-(4-fluorophenyl)-2-methyl-6-(5-piperidin-1-ylpentoxy)pyrimidine |
| InChIKey | SZSHJTJCJOWMHM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)OCCCCCN2CCCCC2)C3=CC=C(C=C3)F |
Dane obliczone przez PubChem (NCBI)