cas: 1217467-39-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ercalcidiol-d3, 99.86% (CAS 1217467-39-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500 μg, 25 mg, 50 mg, 100 μg, 10 mg, 5 mg, 1 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-32349S-500 μg |
| cas | 1217467-39-4 |
| opakowanie | 500 μg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 500 μg | 3863,06 Pln | |
| MedChemExpress | 25 mg | 25378,72 Pln | |
| MedChemExpress | 50 mg | 32953,08 Pln | |
| MedChemExpress | 100 μg | 1369,24 Pln | |
| MedChemExpress | 10 mg | 16959,14 Pln | |
| MedChemExpress | 5 mg | 12593,78 Pln | |
| MedChemExpress | 1 mg | 5734,60 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.86% |
(1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-deuterioethylidene]-4-(dideuteriomethylidene)cyclohexan-1-ol (CAS 1217467-39-4) to związek chemiczny o wzorze sumarycznym C28H44O2 i masie molowej 415.7 g/mol. Nazwa systematyczna IUPAC: (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-deuterioethylidene]-4-(dideuteriomethylidene)cyclohexan-1-ol. InChIKey: KJKIIUAXZGLUND-ABHIMYCLSA-N.
| Wzór sumaryczny | C28H44O2 |
|---|---|
| Masa molowa | 415.7 g/mol |
| Nazwa IUPAC | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-deuterioethylidene]-4-(dideuteriomethylidene)cyclohexan-1-ol |
| InChIKey | KJKIIUAXZGLUND-ABHIMYCLSA-N |
| SMILES | [2H]C(=C/1CC[C@@H](C\C1=C(\[2H])/C=C/2\CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)C=C[C@H](C)C(C)(C)O)C)O)[2H] |
Dane obliczone przez PubChem (NCBI)