cas: 2998-57-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Estramustine, 99.25% ,, 99.25% , (CAS 2998-57-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BBV4-1mg |
| cas | 2998-57-4 |
| opakowanie | 1mg |
| dostępność | 2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 213,20 Pln | |
| Chemat | 5mg | 386,00 Pln | |
| Chemat | 25mg | 482,00 Pln | |
| Chemat | 50mg | 568,40 Pln | |
| Chemat | 100mg | 736,40 Pln | |
| Chemat | 250mg | 1624,40 Pln | |
| Chemat | 1g | 4749,20 Pln |
| czystość | 99.25% , |
|---|---|
| czas dostawy | 3 tygodnie |
[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate (CAS 2998-57-4) to związek chemiczny o wzorze sumarycznym C23H31Cl2NO3 i masie molowej 440.4 g/mol. Nazwa systematyczna IUPAC: [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate. InChIKey: FRPJXPJMRWBBIH-RBRWEJTLSA-N.
| Wzór sumaryczny | C23H31Cl2NO3 |
|---|---|
| Masa molowa | 440.4 g/mol |
| Nazwa IUPAC | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate |
| InChIKey | FRPJXPJMRWBBIH-RBRWEJTLSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)OC(=O)N(CCCl)CCCl |
Dane obliczone przez PubChem (NCBI)