Ethanone, 1-(3-bromophenyl)-2,2,2-trifluoro-, 97%
cas: 655-26-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ethanone, 1-(3-bromophenyl)-2,2,2-trifluoro-, 97% (CAS 655-26-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11EE71-250mg |
| cas | 655-26-5 |
| opakowanie | 250mg |
| dostępność | 800g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 107,60 Pln | |
| Chemat | 5g | 213,20 Pln | |
| Chemat | 10g | 362,00 Pln | |
| Chemat | 25g | 602,00 Pln | |
| Chemat | 100g | 1845,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1-(3-bromophenyl)-2,2,2-trifluoroethanone (CAS 655-26-5) to związek chemiczny o wzorze sumarycznym C8H4BrF3O i masie molowej 253.02 g/mol. Nazwa systematyczna IUPAC: 1-(3-bromophenyl)-2,2,2-trifluoroethanone. InChIKey: JOKNUXPHMQZTQB-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H4BrF3O |
|---|---|
| Masa molowa | 253.02 g/mol |
| Nazwa IUPAC | 1-(3-bromophenyl)-2,2,2-trifluoroethanone |
| InChIKey | JOKNUXPHMQZTQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3'-Bromo-2,2,2-trifluoroacetophenone, 1-(3-bromophenyl)-2,2,2-trifluoroethanone, 1-(3-Bromophenyl)-2,2,2-Trifluoroethan-1-One, Ethanone, 1-(3-bromophenyl)-2,2,2-trifluoro-, 3 inverted exclamation marka-Bromo-2,2,2-trifluoroacetophenone, 3'-Bromo-2,2,2-trifluoroacetophenone, 97%, 3 inverted exclamation mark -Bromo-2,2,2-trifluoroacetophenone, 1-bromo-3-(trifluoroacetyl)benzene, 3-Bromo-|A,|A,|A-trifluoroacetophenone, 1-(3-bromo-phenyl)-2,2,2-trifluoro-eth
