Ethyl 2-([1,1′-Biphenyl]-4-yl)-2,2-difluoroacetate, 97%
cas: 73789-98-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ethyl 2-([1,1′-Biphenyl]-4-yl)-2,2-difluoroacetate, 97% (CAS 73789-98-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11ICG3-100mg |
| cas | 73789-98-7 |
| opakowanie | 100mg |
| dostępność | 15g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 165,20 Pln | |
| Chemat | 250mg | 270,80 Pln | |
| Chemat | 1g | 573,20 Pln | |
| Chemat | 5g | 1605,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Ethyl 2,2-difluoro-2-(4-phenylphenyl)acetate (CAS 73789-98-7) to związek chemiczny o wzorze sumarycznym C16H14F2O2 i masie molowej 276.28 g/mol. Nazwa systematyczna IUPAC: ethyl 2,2-difluoro-2-(4-phenylphenyl)acetate. InChIKey: MOLYMHPFNGLCBJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H14F2O2 |
|---|---|
| Masa molowa | 276.28 g/mol |
| Nazwa IUPAC | ethyl 2,2-difluoro-2-(4-phenylphenyl)acetate |
| InChIKey | MOLYMHPFNGLCBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)C2=CC=CC=C2)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Ethyl 2-(4-Biphenylyl)-2,2-difluoroacetate, Ethyl 2-([1,1'-biphenyl]-4-yl)-2,2-difluoroacetate, ethyl 2,2-difluoro-2-(4-phenylphenyl)acetate, ethyl 2-{[1,1'-biphenyl]-4-yl}-2,2-difluoroacetate, [1,1'-Biphenyl]-4-acetic acid, alpha,alpha-difluoro-, ethyl ester, Ethyl2-(4-Biphenylyl)-2,2-difluoroacetate, ethyl 2-(biphenyl-4-yl)-2,2-difluoroacetate, 2-(biphenyl-4-yl)-2,2-difluoroacetic acid ethyl ester, [1,1'-Biphenyl]-4-aceticacid,alpha,alpha-difluoro-,ethylester
![Ethyl 2-([1,1'-biphenyl]-4-yl)-2,2-difluoroacetate, 97%](https://cdn.chemat.com.pl/products/images/7e8bdb13ed8dd4128a96e858be38fdc7a91e0844bf1abd729b33bcbdf4db7505.svg)