Ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate, ≥98%
cas: 141546-96-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate, ≥98% (CAS 141546-96-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | AG003I7S-250mg |
| cas | 141546-96-5 |
| opakowanie | 250mg |
| dostępność | 6g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 376,40 Pln | |
| Chemat | 1g | 851,60 Pln | |
| Chemat | 250mg | 376,40 Pln | |
| Chemat | 1g | 851,60 Pln |
właściwości
| czystość | ≥98% |
|---|---|
| czas dostawy | 3 tygodnie |
Ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate (CAS 141546-96-5) to związek chemiczny o wzorze sumarycznym C9H17F2NO3 i masie molowej 225.23 g/mol. Nazwa systematyczna IUPAC: ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate. InChIKey: WQKRWROIDBGNCS-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H17F2NO3 |
|---|---|
| Masa molowa | 225.23 g/mol |
| Nazwa IUPAC | ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate |
| InChIKey | WQKRWROIDBGNCS-UHFFFAOYSA-N |
| SMILES | CCOC(C(C(=O)OCC)(F)F)N(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate, 3-(Dimethylamino)-3-ethoxy-2,2-difluoropropionic Acid Ethyl Ester, Ethyl 3-(Dimethylamino)-3-ethoxy-2,2-difluoropropionate, ethyl3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate, ethyl 3-(dimethylamino)-3-ethoxy-2,2-difluoro-propanoate