Ethyl benzofuran-2-carboxylate, 98%, 98%
cas: 3199-61-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ethyl benzofuran-2-carboxylate, 98%, 98% (CAS 3199-61-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BYGU-250mg |
| cas | 3199-61-9 |
| opakowanie | 250mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 194,00 Pln | |
| Chemat | 10g | 314,00 Pln | |
| Chemat | 25g | 659,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Ethyl 1-benzofuran-2-carboxylate (CAS 3199-61-9) to związek chemiczny o wzorze sumarycznym C11H10O3 i masie molowej 190.19 g/mol. Nazwa systematyczna IUPAC: ethyl 1-benzofuran-2-carboxylate. InChIKey: KAWQPOUWLVOHKU-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H10O3 |
|---|---|
| Masa molowa | 190.19 g/mol |
| Nazwa IUPAC | ethyl 1-benzofuran-2-carboxylate |
| InChIKey | KAWQPOUWLVOHKU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC=CC=C2O1 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
ethyl 1-benzofuran-2-carboxylate, 2-benzofurancarboxylic acid, ethyl ester, InChI=1/C11H10O3/c1-2-13-11(12)10-7-8-5-3-4-6-9(8)14-10/h3-7H,2H2,1H, Ethyl Benzofuran-2-carboxylate, 2-Benzofurancarboxylic acid ethyl ester, Ethyl 2-benzofurancarboxylate, Ethyl coumarilate, benzofuran-2-carboxylic acid ethyl ester, Ethyl benzofuran-2-carboxylate, 97%, 2-carbethoxybenzofuran