cas: 143655-58-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Exatecan Intermediate 6, 99.95% (CAS 143655-58-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 g, 25 g, 1 g, 10 g, 250 mg, 10mM/1mL, 5 g, 50 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-44369-100 g |
| cas | 143655-58-7 |
| opakowanie | 100 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 g | 7318,20 Pln | |
| MedChemExpress | 25 g | 2613,83 Pln | |
| MedChemExpress | 1 g | 361,49 Pln | |
| MedChemExpress | 10 g | 1127,75 Pln | |
| MedChemExpress | 250 mg | 240,74 Pln | |
| MedChemExpress | 10mM/1mL | 254,68 Pln | |
| MedChemExpress | 5 g | 742,30 Pln | |
| MedChemExpress | 50 g | 4364,62 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.95% |
N-(3-fluoro-4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide (CAS 143655-58-7) to związek chemiczny o wzorze sumarycznym C13H14FNO2 i masie molowej 235.25 g/mol. Nazwa systematyczna IUPAC: N-(3-fluoro-4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide. InChIKey: PSNRFAKPOCIEDV-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H14FNO2 |
|---|---|
| Masa molowa | 235.25 g/mol |
| Nazwa IUPAC | N-(3-fluoro-4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide |
| InChIKey | PSNRFAKPOCIEDV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C2=C1CCCC2=O)NC(=O)C)F |
Dane obliczone przez PubChem (NCBI)