Felodipine 3,5-dimethyl ester
cas: 91189-59-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Felodipine 3,5-dimethyl ester (CAS 91189-59-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 25 mg, 100 mg, 10 mg, 50 mg, 5 mg. Oferty producentów: Biosynth, MedChemExpress.
| producent | Biosynth |
|---|---|
| nr katalogowy | FF23239-50mg |
| cas | 91189-59-2 |
| opakowanie | 50mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Biosynth | 50mg | cena na żądanie | |
| MedChemExpress | 25 mg | 1150,97 Pln | |
| MedChemExpress | 100 mg | 2757,79 Pln | |
| MedChemExpress | 10 mg | 649,42 Pln | |
| MedChemExpress | 50 mg | 1773,26 Pln | |
| MedChemExpress | 5 mg | 454,37 Pln |
właściwości
| kategoria | Research Chemicals |
|---|---|
| podkategoria 1 | Sourcing |
| czystość | No data |
| czas dostawy | 3-4 tygodnie |
Dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 91189-59-2) to związek chemiczny o wzorze sumarycznym C17H17Cl2NO4 i masie molowej 370.2 g/mol. Nazwa systematyczna IUPAC: dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: VEACAIASCBTOFS-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H17Cl2NO4 |
|---|---|
| Masa molowa | 370.2 g/mol |
| Nazwa IUPAC | dimethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | VEACAIASCBTOFS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Felodipine 3,5-Dimethyl Ester, Felodipine EP Impurity B, Clevidipine Impurity B;Felodipine EP Impurity B, C17H17Cl2NO4, orb1310896, orb3025553, orb3173328, FELODIPINE IMPURITY B [EP IMPURITY], Clevidipine Impurity B; Felodipine EP Impurity B, Felodipine EP Impurity B (Felodipine Dimethyl Ester)