Fluoranthen-3-ylboronic acid, 97%, 97%
cas: 359012-63-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fluoranthen-3-ylboronic acid, 97%, 97% (CAS 359012-63-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114QLO-100mg |
| cas | 359012-63-8 |
| opakowanie | 100mg |
| dostępność | 150g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 198,80 Pln | |
| Chemat | 10g | 323,60 Pln | |
| Chemat | 25g | 664,40 Pln | |
| Chemat | 50g | 1202,00 Pln | |
| Chemat | 100g | 2301,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Fluoranthen-3-ylboronic acid (CAS 359012-63-8) to związek chemiczny o wzorze sumarycznym C16H11BO2 i masie molowej 246.1 g/mol. Nazwa systematyczna IUPAC: fluoranthen-3-ylboronic acid. InChIKey: LDPCTBXVSGTSNJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H11BO2 |
|---|---|
| Masa molowa | 246.1 g/mol |
| Nazwa IUPAC | fluoranthen-3-ylboronic acid |
| InChIKey | LDPCTBXVSGTSNJ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C3C2=C(C=C1)C4=CC=CC=C43)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Fluoranthen-3-ylboronic acid, (fluoranthen-3-yl)boronic acid, Fluoranthen-3-ylboronicacid, Fluoranthen-3-ylboronic acid;Boronic acid, B-3-fluoranthenyl-, Boronic acid, 3-fluoranthenyl-, 3-fluorantheneboronic acid, Fluoranthene-3-boronicacid, Fluoranthene-3-boronicacid,95%, LDPCTBXVSGTSNJ-UHFFFAOYSA-N, Fluoranthen-3-ylboronic acid;Boronic acid,B-3-luoranthenyl-