cas: 159610-89-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-Lys(N3)-OH, 98%, 98% (CAS 159610-89-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112R9M-100mg |
| cas | 159610-89-6 |
| opakowanie | 100mg |
| dostępność | 250g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 93,20 Pln | |
| Chemat | 250mg | 117,20 Pln | |
| Chemat | 1g | 184,40 Pln | |
| Chemat | 5g | 611,60 Pln | |
| Chemat | 10g | 1029,20 Pln | |
| Chemat | 25g | 1782,80 Pln | |
| Chemat | 50g | 3155,60 Pln | |
| Chemat | 100g | 4850,00 Pln | |
| Chemat | 250g | 8176,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 159610-89-6) to związek chemiczny o wzorze sumarycznym C21H22N4O4 i masie molowej 394.4 g/mol. Nazwa systematyczna IUPAC: (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PJRFTUILPGJJIO-IBGZPJMESA-N.
| Wzór sumaryczny | C21H22N4O4 |
|---|---|
| Masa molowa | 394.4 g/mol |
| Nazwa IUPAC | (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PJRFTUILPGJJIO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O |
Dane obliczone przez PubChem (NCBI)