cas: 166881-42-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-N-(2,4-dimethoxybenzyl)-Gly-OH, 98%, 98% (CAS 166881-42-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112WZ0-100mg |
| cas | 166881-42-1 |
| opakowanie | 100mg |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 74,00 Pln | |
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 102,80 Pln | |
| Chemat | 5g | 256,40 Pln | |
| Chemat | 10g | 419,60 Pln | |
| Chemat | 25g | 890,00 Pln | |
| Chemat | 50g | 1302,80 Pln | |
| Chemat | 100g | 1782,80 Pln | |
| Chemat | 250g | 3851,60 Pln | |
| Chemat | 500g | 6336,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 166881-42-1) to związek chemiczny o wzorze sumarycznym C26H25NO6 i masie molowej 447.5 g/mol. Nazwa systematyczna IUPAC: 2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: UIDQSTVPYKMCEY-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H25NO6 |
|---|---|
| Masa molowa | 447.5 g/mol |
| Nazwa IUPAC | 2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | UIDQSTVPYKMCEY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CN(CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC |
Dane obliczone przez PubChem (NCBI)