cas: 2170484-59-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-N-PEG24-acid, 99.91% (CAS 2170484-59-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 g, 1 g, 100 mg, 10 g, 250 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-130907-5 g |
| cas | 2170484-59-8 |
| opakowanie | 5 g |
| dostępność | Get quote |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 g | 9547,32 Pln | |
| MedChemExpress | 1 g | 2493,08 Pln | |
| MedChemExpress | 100 mg | 719,08 Pln | |
| MedChemExpress | 10 g | 15203,71 Pln | |
| MedChemExpress | 250 mg | 1081,31 Pln | |
| MedChemExpress | 50 mg | 551,89 Pln |
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.91% |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2170484-59-8) to związek chemiczny o wzorze sumarycznym C66H113NO28 i masie molowej 1368.6 g/mol. Nazwa systematyczna IUPAC: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: NFOMZHGRFWXDGH-UHFFFAOYSA-N.
| Wzór sumaryczny | C66H113NO28 |
|---|---|
| Masa molowa | 1368.6 g/mol |
| Nazwa IUPAC | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | NFOMZHGRFWXDGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Dane obliczone przez PubChem (NCBI)