cas: 1821797-58-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-N-methyl-L-alloisoleucine (CAS 1821797-58-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T72045-1mg |
| cas | 1821797-58-3 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 1428,68 Pln | |
| TargetMol | 5mg | 2909,47 Pln | |
| TargetMol | 10mg | 4211,38 Pln | |
| TargetMol | 25mg | 6422,79 Pln | |
| TargetMol | 50mg | 8780,09 Pln | |
| TargetMol | 100mg | 11741,67 Pln | |
| TargetMol | 500mg | 23416,39 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 19 dni |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid (CAS 1821797-58-3) to związek chemiczny o wzorze sumarycznym C22H25NO4 i masie molowej 367.4 g/mol. Nazwa systematyczna IUPAC: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid. InChIKey: IQIOLCJHRZWOLS-VLIAUNLRSA-N.
| Wzór sumaryczny | C22H25NO4 |
|---|---|
| Masa molowa | 367.4 g/mol |
| Nazwa IUPAC | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid |
| InChIKey | IQIOLCJHRZWOLS-VLIAUNLRSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Dane obliczone przez PubChem (NCBI)