Fmoc-PhNle-OH, 95%, 95%
cas: 2350732-99-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-PhNle-OH, 95%, 95% (CAS 2350732-99-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12JP0R-100mg |
| cas | 2350732-99-7 |
| opakowanie | 100mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 174,80 Pln | |
| Chemat | 250mg | 266,00 Pln | |
| Chemat | 1g | 611,60 Pln | |
| Chemat | 5g | 2248,40 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhexanoic acid (CAS 2350732-99-7) to związek chemiczny o wzorze sumarycznym C27H27NO4 i masie molowej 429.5 g/mol. Nazwa systematyczna IUPAC: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhexanoic acid. InChIKey: NZOVBPGEEROSSE-VWLOTQADSA-N.
| Wzór sumaryczny | C27H27NO4 |
|---|---|
| Masa molowa | 429.5 g/mol |
| Nazwa IUPAC | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhexanoic acid |
| InChIKey | NZOVBPGEEROSSE-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)CCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Fmoc-PhNle-OH, (S)-2-(Fmoc-amino)-6-phenylhexanoic acid, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-phenylhexanoic acid, Fmoc-(S)-2-amino-6-phenylhexanoic acid, (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhexanoic acid, (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenyl-hexanoic acid, (2S)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)-6-phenylhexanoic acid - [F89108]