cas: 95753-55-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Fmoc-Phe(4-NO2)-OH, 98%, 98% (CAS 95753-55-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IJFV-250mg |
| cas | 95753-55-2 |
| opakowanie | 250mg |
| dostępność | 525g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 74,00 Pln | |
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 98,00 Pln | |
| Chemat | 10g | 122,00 Pln | |
| Chemat | 25g | 208,40 Pln | |
| Chemat | 100g | 645,20 Pln | |
| Chemat | 500g | 2491,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid (CAS 95753-55-2) to związek chemiczny o wzorze sumarycznym C24H20N2O6 i masie molowej 432.4 g/mol. Nazwa systematyczna IUPAC: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid. InChIKey: RZRRJPNDKJOLHI-QFIPXVFZSA-N.
| Wzór sumaryczny | C24H20N2O6 |
|---|---|
| Masa molowa | 432.4 g/mol |
| Nazwa IUPAC | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid |
| InChIKey | RZRRJPNDKJOLHI-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)[N+](=O)[O-])C(=O)O |
Dane obliczone przez PubChem (NCBI)