cas: 1680196-54-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
FzM1, 98.72% (CAS 1680196-54-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 mg, 100 mg, 50 mg, 10 mg, 10mM/1mL, 5 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-116553-1 mg |
| cas | 1680196-54-6 |
| opakowanie | 1 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 mg | 407,93 Pln | |
| MedChemExpress | 100 mg | 3454,39 Pln | |
| MedChemExpress | 50 mg | 2126,21 Pln | |
| MedChemExpress | 10 mg | 709,79 Pln | |
| MedChemExpress | 10mM/1mL | 459,01 Pln | |
| MedChemExpress | 5 mg | 463,66 Pln | |
| MedChemExpress | 25 mg | 1304,22 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.72% |
1-(3-hydroxy-5-thiophen-2-ylphenyl)-3-naphthalen-2-ylurea (CAS 1680196-54-6) to związek chemiczny o wzorze sumarycznym C21H16N2O2S i masie molowej 360.4 g/mol. Nazwa systematyczna IUPAC: 1-(3-hydroxy-5-thiophen-2-ylphenyl)-3-naphthalen-2-ylurea. InChIKey: OBTSACXGWYGCPK-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H16N2O2S |
|---|---|
| Masa molowa | 360.4 g/mol |
| Nazwa IUPAC | 1-(3-hydroxy-5-thiophen-2-ylphenyl)-3-naphthalen-2-ylurea |
| InChIKey | OBTSACXGWYGCPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)NC3=CC(=CC(=C3)C4=CC=CS4)O |
Dane obliczone przez PubChem (NCBI)