cas: 24269-96-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
GRK2 Inhibitor 1, 98.06% (CAS 24269-96-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 25 mg, 50 mg, 10mM/1mL, 100 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-123538-10 mg |
| cas | 24269-96-3 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 1318,15 Pln | |
| MedChemExpress | 25 mg | 2757,79 Pln | |
| MedChemExpress | 50 mg | 4197,43 Pln | |
| MedChemExpress | 10mM/1mL | 909,48 Pln | |
| MedChemExpress | 100 mg | 6598,38 Pln | |
| MedChemExpress | 5 mg | 839,82 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.06% |
Methyl 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate (CAS 24269-96-3) to związek chemiczny o wzorze sumarycznym C12H9NO6 i masie molowej 263.20 g/mol. Nazwa systematyczna IUPAC: methyl 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate. InChIKey: YDJPHSNZGRVPCK-NSCUHMNNSA-N.
| Wzór sumaryczny | C12H9NO6 |
|---|---|
| Masa molowa | 263.20 g/mol |
| Nazwa IUPAC | methyl 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate |
| InChIKey | YDJPHSNZGRVPCK-NSCUHMNNSA-N |
| SMILES | COC(=O)C1=CC=C(O1)/C=C/C2=CC=C(O2)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)