cas: 529-49-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Gentisein, 98.07% (CAS 529-49-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 25 mg, 10mM/1mL, 10 mg, 5 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-118166-100 mg |
| cas | 529-49-7 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 1847,57 Pln | |
| MedChemExpress | 25 mg | 793,38 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 10 mg | 454,37 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 50 mg | 1197,41 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.07% |
1,3,7-trihydroxyxanthen-9-one (CAS 529-49-7) to związek chemiczny o wzorze sumarycznym C13H8O5 i masie molowej 244.20 g/mol. Nazwa systematyczna IUPAC: 1,3,7-trihydroxyxanthen-9-one. InChIKey: JJUNZBRHHGLJQW-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H8O5 |
|---|---|
| Masa molowa | 244.20 g/mol |
| Nazwa IUPAC | 1,3,7-trihydroxyxanthen-9-one |
| InChIKey | JJUNZBRHHGLJQW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C3=C(C=C(C=C3O2)O)O |
Dane obliczone przez PubChem (NCBI)